BIOPEP-UWM: Report
| ID | 295 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of alpha-glucosidase (EC 3.2.1.20) (PDB ID: 5NN8) | |||
| Number of residues | 9 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 927.0949 | Monoisotopic mass | 926.5209 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kęska P., Stadnik J., Łupawka A., Michalska A. | |
| Title | |
| Novel α-glucosidase inhibitory peptides identified in silico from dry-cured pork loins with probiotics through peptidomic and molecular docking analysis. Nutrients, 15, 3539, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C45H70N10O11/c1-27(56)36(47)44(64)55-26-10-18-35(55)43(63)54-25-9-17-34(54)42(62)53-24-8-16-33(53)41(61)52-23-7-15-32(52)40(60)51-22-6-14-31(51)39(59)50-21-5-13-30(50)38(58)49-20-4-12-29(49)37(57)48-28(45(65)66)11-2-3-19-46/h27-36,56H,2-26,46-47H2,1H3,(H,48,57)(H,65,66)/t27-,28+,29+,30+,31+,32+,33+,34+,35+,36+/m1/s1 InChIKey=CRXNUESSGZYWDY-WCULSOBJSA-N |
| Database reference: |