BIOPEP-UWM: Report
| ID | 296 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 4CA5) | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 822.9494 | Monoisotopic mass | 822.4698 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishak N.H., Shaik M.I., Yellapu N.K., Howell N.K., Sarbon N.M. | |
| Title | |
| Purification, characterization and molecular docking study of angiotensin-I converting enzyme (ACE) inhibitory peptide from shortfin scad (Decapterus macrosoma) protein hydrolysate. J. Food Sci. Technol., 58(12), 4567-4577, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C36H62N12O10/c1-18(2)27(45-25(49)16-41-30(52)22(37)10-7-13-40-36(38)39)33(55)42-17-26(50)47-14-8-11-23(47)32(54)46-28(19(3)4)34(56)48-15-9-12-24(48)31(53)43-20(5)29(51)44-21(6)35(57)58/h18-24,27-28H,7-17,37H2,1-6H3,(H,41,52)(H,42,55)(H,43,53)(H,44,51)(H,45,49)(H,46,54)(H,57,58)(H4,38,39,40)/t20-,21-,22-,23-,24-,27-,28-/m0/s1 InChIKey=IEERYNDQLALGFI-MVVSZOHLSA-N Bioactivity predicted by molecular docking |
| Database reference: |