BIOPEP-UWM: Report
| ID | 303 |
| Name | Pancreatic elastase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Pancreatic elastase (EC 3.4.21.36) (MEROPS ID: S01.153) (PDB ID: 1LVY) | |||
| Number of residues | 8 |
Activity code | pel |
| Activity : | pancreatic elastase inhibitor |
|||
| Chemical mass | 1033.3073 | Monoisotopic mass | 1032.6788 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Aguilar-Toalá J.E., Liceaga A.M. | |
| Title | |
| Identification of chia seed (Salvia hispanica L.) peptides with enzyme inhibition activity towards skin-aging enzymes. Amino Acids, 52(8), 1149-1159, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C49H88N14O10/c1-28(2)26-37(60-43(67)34(15-8-11-23-51)57-41(65)33(53)14-7-10-22-50)45(69)59-35(16-9-12-24-52)42(66)58-36(17-13-25-56-49(54)55)44(68)62-39(29(3)4)47(71)61-38(27-31-18-20-32(64)21-19-31)46(70)63-40(30(5)6)48(72)73/h18-21,28-30,33-40,64H,7-17,22-27,50-53H2,1-6H3,(H,57,65)(H,58,66)(H,59,69)(H,60,67)(H,61,71)(H,62,68)(H,63,70)(H,72,73)(H4,54,55,56)/t33-,34-,35-,36-,37-,38-,39-,40-/m0/s1 InChIKey=WNOLIXGAGXRBJH-TZPCGENMSA-N Bioactivity predicted by molecular docking |
| Database reference: |