BIOPEP-UWM: Report
| ID | 305 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of alpha-glucosidase (EC 3.2.1.20) (PDB ID: 5NN8) | |||
| Number of residues | 11 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 1137.2845 | Monoisotopic mass | 1136.5960 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wójciak K. M., Kęska P. | |
| Title | |
| Biological activity of canned pork meat fortified black currant leaf extract: in vitro, in silico, and molecular docking study. Molecules, 28, 8009, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C53H80N14O14/c1-30(42(70)59-32(52(80)81)29-41(68)69)58-43(71)33-12-3-21-60(33)45(73)35-14-5-23-62(35)47(75)37-16-7-25-64(37)49(77)39-18-9-27-66(39)51(79)40-19-10-28-67(40)50(78)38-17-8-26-65(38)48(76)36-15-6-24-63(36)46(74)34-13-4-22-61(34)44(72)31(54)11-2-20-57-53(55)56/h30-40H,2-29,54H2,1H3,(H,58,71)(H,59,70)(H,68,69)(H,80,81)(H4,55,56,57)/t30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-/m0/s1 InChIKey=GPPXKQFNULWROS-CFUXOSHRSA-N |
| Database reference: |