BIOPEP-UWM: Report
| ID | 308 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O8A) | |||
| Number of residues | 11 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1219.3815 | Monoisotopic mass | 1218.6264 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Z., Zhang M., Zhao C., Li J., Wang J., Ma C., Ma D. | |
| Title | |
| ACE-inhibitory peptides in sodium-reduced cheese with probiotic: Identification, in silico prediction and molecular interaction. LWT, 200, 116198, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C60H93N15O15/c1-33(2)29-39(68-56(86)49(35(5)6)71-54(84)43-20-13-27-74(43)57(87)37(61)22-23-47(78)79)51(81)66-32-46(77)73-26-12-19-42(73)53(83)70-48(34(3)4)55(85)67-38(17-10-24-64-60(62)63)50(80)65-31-45(76)72-25-11-18-41(72)52(82)69-40(30-36-15-8-7-9-16-36)58(88)75-28-14-21-44(75)59(89)90/h7-9,15-16,33-35,37-44,48-49H,10-14,17-32,61H2,1-6H3,(H,65,80)(H,66,81)(H,67,85)(H,68,86)(H,69,82)(H,70,83)(H,71,84)(H,78,79)(H,89,90)(H4,62,63,64)/t37-,38-,39-,40-,41-,42-,43-,44-,48-,49-/m0/s1 InChIKey=IODNFPWXOZMJTE-LJJXVHAZSA-N Bioactivity predicted by molecular docking |
| Database reference: |