BIOPEP-UWM: Report
| ID | 309 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O8A) | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 991.1371 | Monoisotopic mass | 990.5158 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Z., Zhang M., Zhao C., Li J., Wang J., Ma C., Ma D. | |
| Title | |
| ACE-inhibitory peptides in sodium-reduced cheese with probiotic: Identification, in silico prediction and molecular interaction. LWT, 200, 116198, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C49H70N10O12/c1-29(2)41(46(67)55-35(26-31-14-6-4-7-15-31)42(63)52-28-39(60)53-34(49(70)71)18-10-11-23-50)57-43(64)33(21-22-40(61)62)54-44(65)38-20-13-25-59(38)48(69)36(27-32-16-8-5-9-17-32)56-45(66)37-19-12-24-58(37)47(68)30(3)51/h4-9,14-17,29-30,33-38,41H,10-13,18-28,50-51H2,1-3H3,(H,52,63)(H,53,60)(H,54,65)(H,55,67)(H,56,66)(H,57,64)(H,61,62)(H,70,71)/t30-,33-,34-,35-,36-,37-,38-,41-/m0/s1 InChIKey=YWLXFYJFFQCWEU-GQORYLLFSA-N Bioactivity predicted by molecular docking |
| Database reference: |