BIOPEP-UWM: Report
| ID | 310 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O8A) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 896.0842 | Monoisotopic mass | 895.5264 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Z., Zhang M., Zhao C., Li J., Wang J., Ma C., Ma D. | |
| Title | |
| ACE-inhibitory peptides in sodium-reduced cheese with probiotic: Identification, in silico prediction and molecular interaction. LWT, 200, 116198, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C44H69N11O9/c1-3-26(2)37(41(60)50-31(18-19-36(48)56)43(62)55-23-11-17-35(55)39(58)51-32(44(63)64)15-7-9-21-46)53-38(57)33(24-27-25-49-30-14-5-4-12-28(27)30)52-40(59)34-16-10-22-54(34)42(61)29(47)13-6-8-20-45/h4-5,12,14,25-26,29,31-35,37,49H,3,6-11,13,15-24,45-47H2,1-2H3,(H2,48,56)(H,50,60)(H,51,58)(H,52,59)(H,53,57)(H,63,64)/t26-,29-,31-,32-,33-,34-,35-,37-/m0/s1 InChIKey=FQUBEYKWOKNUMV-DMUIZNORSA-N Bioactivity predicted by molecular docking |
| Database reference: |