BIOPEP-UWM: Report
| ID | 312 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O8A) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1100.2627 | Monoisotopic mass | 1099.5684 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Z., Zhang M., Zhao C., Li J., Wang J., Ma C., Ma D. | |
| Title | |
| ACE-inhibitory peptides in sodium-reduced cheese with probiotic: Identification, in silico prediction and molecular interaction. LWT, 200, 116198, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C55H77N11O13/c1-5-32(4)46(54(77)66-26-12-18-42(66)49(72)61-38(55(78)79)29-43(56)68)62-50(73)40-16-9-23-63(40)44(69)30-58-47(70)39-15-10-24-64(39)52(75)36(27-33-13-7-6-8-14-33)59-48(71)41-17-11-25-65(41)53(76)37(60-51(74)45(57)31(2)3)28-34-19-21-35(67)22-20-34/h6-8,13-14,19-22,31-32,36-42,45-46,67H,5,9-12,15-18,23-30,57H2,1-4H3,(H2,56,68)(H,58,70)(H,59,71)(H,60,74)(H,61,72)(H,62,73)(H,78,79)/t32-,36-,37-,38-,39-,40-,41-,42-,45-,46-/m0/s1 InChIKey=VTCRHWWUPSWJFP-NCWXGXPASA-N Bioactivity predicted by molecular docking |
| Database reference: |