BIOPEP-UWM: Report
| ID | 322 |
| Name | Predicted osteoanabolic peptide |
| sequence |
| Function: | |||
| Predicted ligand of Epidermal growth factor receptor (EGFR) (PDB ID: 1IV0) | |||
| Number of residues | 4 |
Activity code | ost |
| Activity : | osteoanabolic |
|||
| Chemical mass | 514.6172 | Monoisotopic mass | 514.3218 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Niu Y., Fu C., Zhu L., Wang H., Yi Y., Xu W., Guo D. | |
| Title | |
| Preparation, identification and screening of anti-osteoporosis milk-derived peptides: Intervention effects in osteoporosis rats. Food Biosci., 62, 105120, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C22H42N8O6/c1-11(2)8-15(29-18(32)13(23)10-17(24)31)20(34)30-16(9-12(3)4)19(33)28-14(21(35)36)6-5-7-27-22(25)26/h11-16H,5-10,23H2,1-4H3,(H2,24,31)(H,28,33)(H,29,32)(H,30,34)(H,35,36)(H4,25,26,27)/t13-,14-,15-,16-/m0/s1 InChIKey=KLQWKYBOJBZURZ-VGWMRTNUSA-N Bioactivity predicted using molecular docking |
| Database reference: |