BIOPEP-UWM: Report
| ID | 326 |
| Name | Predicted osteoanabolic peptide |
| sequence |
| Function: | |||
| Predicted ligand of Epidermal growth factor receptor (EGFR) (PDB ID: 1IV0) | |||
| Number of residues | 7 |
Activity code | ost |
| Activity : | osteoanabolic |
|||
| Chemical mass | 779.9643 | Monoisotopic mass | 779.4890 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Niu Y., Fu C., Zhu L., Wang H., Yi Y., Xu W., Guo D. | |
| Title | |
| Preparation, identification and screening of anti-osteoporosis milk-derived peptides: Intervention effects in osteoporosis rats. Food Biosci., 62, 105120, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C37H65N9O9/c1-20(2)19-25(43-34(51)29(40)21(3)4)35(52)45-17-9-13-27(45)33(50)44-30(22(5)6)36(53)46-18-10-12-26(46)32(49)41-23(14-15-28(39)47)31(48)42-24(37(54)55)11-7-8-16-38/h20-27,29-30H,7-19,38,40H2,1-6H3,(H2,39,47)(H,41,49)(H,42,48)(H,43,51)(H,44,50)(H,54,55)/t23-,24-,25-,26-,27-,29-,30-/m0/s1 InChIKey=NKNBSECGZPVWGH-YYLRFZLMSA-N Bioactivity predicted using molecular docking |
| Database reference: |