BIOPEP-UWM: Report
| ID | 329 |
| Name | Predicted osteoanabolic peptide |
| sequence |
| Function: | |||
| Predicted ligand of Epidermal growth factor receptor (EGFR) (PDB ID: 1IV0) | |||
| Number of residues | 10 |
Activity code | ost |
| Activity : | osteoanabolic |
|||
| Chemical mass | 1157.3155 | Monoisotopic mass | 1156.6221 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Niu Y., Fu C., Zhu L., Wang H., Yi Y., Xu W., Guo D. | |
| Title | |
| Preparation, identification and screening of anti-osteoporosis milk-derived peptides: Intervention effects in osteoporosis rats. Food Biosci., 62, 105120, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C53H84N14O15/c1-27(2)24-36(45(74)59-26-40(70)66-22-8-11-37(66)47(76)64-42(28(3)4)49(78)62-35(52(81)82)10-7-21-58-53(56)57)63-50(79)43(29(5)6)65-48(77)38-12-9-23-67(38)51(80)34(18-20-41(71)72)61-46(75)33(17-19-39(55)69)60-44(73)32(54)25-30-13-15-31(68)16-14-30/h13-16,27-29,32-38,42-43,68H,7-12,17-26,54H2,1-6H3,(H2,55,69)(H,59,74)(H,60,73)(H,61,75)(H,62,78)(H,63,79)(H,64,76)(H,65,77)(H,71,72)(H,81,82)(H4,56,57,58)/t32-,33-,34-,35-,36-,37-,38-,42-,43-/m0/s1 InChIKey=VMYAGHAFFKXAHV-ABCDUJAMSA-N Bioactivity predicted using molecular docking |
| Database reference: |