BIOPEP-UWM: Report
| ID | 335 |
| Name | Predicted osteoanabolic peptide |
| sequence |
| Function: | |||
| Predicted ligand of Epidermal growth factor receptor (EGFR) (PDB ID: 1IV0) | |||
| Number of residues | 8 |
Activity code | ost |
| Activity : | osteoanabolic |
|||
| Chemical mass | 958.1122 | Monoisotopic mass | 957.5380 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Niu Y., Fu C., Zhu L., Wang H., Yi Y., Xu W., Guo D. | |
| Title | |
| Preparation, identification and screening of anti-osteoporosis milk-derived peptides: Intervention effects in osteoporosis rats. Food Biosci., 62, 105120, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C21H38N6O8/c1-11(2)9-12(23)18(31)25-13(6-7-16(24)28)19(32)27-15(10-17(29)30)20(33)26-14(21(34)35)5-3-4-8-22/h11-15H,3-10,22-23H2,1-2H3,(H2,24,28)(H,25,31)(H,26,33)(H,27,32)(H,29,30)(H,34,35)/t12-,13-,14-,15-/m0/s1 InChIKey=KEWLCVWYOQAKGN-AJNGGQMLSA-N Bioactivity predicted using molecular docking |
| Database reference: |