BIOPEP-UWM: Report
| ID | 339 |
| Name | Predicted osteoanabolic peptide |
| sequence |
| Function: | |||
| Predicted ligand of Epidermal growth factor receptor (EGFR) (PDB ID: 1IV0) | |||
| Number of residues | 4 |
Activity code | ost |
| Activity : | osteoanabolic |
|||
| Chemical mass | 584.6194 | Monoisotopic mass | 584.2586 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Niu Y., Fu C., Zhu L., Wang H., Yi Y., Xu W., Guo D. | |
| Title | |
| Preparation, identification and screening of anti-osteoporosis milk-derived peptides: Intervention effects in osteoporosis rats. Food Biosci., 62, 105120, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C28H36N6O8/c29-19(10-12-23(30)36)25(38)33-21(14-16-4-2-1-3-5-16)27(40)34-22(15-17-6-8-18(35)9-7-17)26(39)32-20(28(41)42)11-13-24(31)37/h1-9,19-22,35H,10-15,29H2,(H2,30,36)(H2,31,37)(H,32,39)(H,33,38)(H,34,40)(H,41,42)/t19-,20-,21-,22-/m0/s1 InChIKey=JZGLSCBALNSHBL-CMOCDZPBSA-N Bioactivity predicted using molecular docking |
| Database reference: |