BIOPEP-UWM: Report
| ID | 341 |
| Name | Predicted osteoanabolic peptide |
| sequence |
| Function: | |||
| Predicted ligand of Epidermal growth factor receptor (EGFR) (PDB ID: 1IV0) | |||
| Number of residues | 4 |
Activity code | ost |
| Activity : | osteoanabolic |
|||
| Chemical mass | 430.4945 | Monoisotopic mass | 430.2419 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Niu Y., Fu C., Zhu L., Wang H., Yi Y., Xu W., Guo D. | |
| Title | |
| Preparation, identification and screening of anti-osteoporosis milk-derived peptides: Intervention effects in osteoporosis rats. Food Biosci., 62, 105120, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C19H34N4O7/c1-6-10(4)15(20)18(28)22-12(8-14(24)25)17(27)21-11(5)16(26)23-13(19(29)30)7-9(2)3/h9-13,15H,6-8,20H2,1-5H3,(H,21,27)(H,22,28)(H,23,26)(H,24,25)(H,29,30)/t10-,11-,12-,13-,15-/m0/s1 InChIKey=BLGVKBNSOLXBHY-CXOVXGEYSA-N Bioactivity predicted using molecular docking |
| Database reference: |