BIOPEP-UWM: Report
| ID | 357 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of pancreatic lipase (EC 3.4.23.1) (PDB ID: 1ETH) | |||
| Number of residues | 4 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 540.7395 | Monoisotopic mass | 540.2431 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Ajayi F. F., Alyafei A. S., Yap P.-G., Gan C.-Y., Maqsood S. | |
| Title | |
| Unlocking the hypolipidemic potential of bioactive peptides derived from probiotic fermented cattle, camel, goat, and sheep milk: a comprehensive investigation through in vitro, in silico, and molecular docking studies. Front. Sustain. Food Syst., 8, 1443708, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C25H40N4O5S2/c1-16(2)14-20(24(32)29-21(25(33)34)15-17-8-6-5-7-9-17)28-23(31)19(11-13-36-4)27-22(30)18(26)10-12-35-3/h5-9,16,18-21H,10-15,26H2,1-4H3,(H,27,30)(H,28,31)(H,29,32)(H,33,34)/t18-,19-,20-,21-/m0/s1 InChIKey=KKKXGUNFJWJALA-TUFLPTIASA-N Activity predicted using molecular docking. |
| Database reference: |