BIOPEP-UWM: Report
| ID | 375 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of pancreatic lipase (EC 3.4.23.1) (PDB ID: 1ETH) | |||
| Number of residues | 12 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 1368.6136 | Monoisotopic mass | 1367.7998 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Ajayi F. F., Alyafei A. S., Yap P.-G., Gan C.-Y., Maqsood S. | |
| Title | |
| Unlocking the hypolipidemic potential of bioactive peptides derived from probiotic fermented cattle, camel, goat, and sheep milk: a comprehensive investigation through in vitro, in silico, and molecular docking studies. Front. Sustain. Food Syst., 8, 1443708, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C62H109N15O19/c1-9-33(5)47(57(90)73-48(34(6)10-2)61(94)77-30-18-23-43(77)56(89)70-41(62(95)96)21-13-16-28-65)72-59(92)50(36(8)79)75-54(87)40(24-25-44(80)81)67-52(85)38(19-11-14-26-63)69-58(91)49(35(7)78)74-53(86)39(20-12-15-27-64)68-55(88)42-22-17-29-76(42)60(93)46(32(3)4)71-51(84)37(66)31-45(82)83/h32-43,46-50,78-79H,9-31,63-66H2,1-8H3,(H,67,85)(H,68,88)(H,69,91)(H,70,89)(H,71,84)(H,72,92)(H,73,90)(H,74,86)(H,75,87)(H,80,81)(H,82,83)(H,95,96)/t33-,34-,35+,36+,37-,38-,39-,40-,41-,42-,43-,46-,47-,48-,49-,50-/m0/s1 InChIKey=NZSAGJPRPOMYMB-XAILSMPGSA-N Activity predicted using molecular docking. |
| Database reference: |