BIOPEP-UWM: Report
| ID | 377 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of pancreatic lipase (EC 3.4.23.1) (PDB ID: 1ETH) | |||
| Number of residues | 13 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 1478.6861 | Monoisotopic mass | 1477.7904 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Ajayi F. F., Alyafei A. S., Yap P.-G., Gan C.-Y., Maqsood S. | |
| Title | |
| Unlocking the hypolipidemic potential of bioactive peptides derived from probiotic fermented cattle, camel, goat, and sheep milk: a comprehensive investigation through in vitro, in silico, and molecular docking studies. Front. Sustain. Food Syst., 8, 1443708, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C69H107N17O19/c1-37(2)29-46(78-58(93)43(17-10-11-25-70)75-57(92)42-18-12-26-73-42)61(96)79-47(30-38(3)4)62(97)80-48(32-41-33-72-36-74-41)67(102)85-27-13-20-53(85)66(101)84-56(39(5)6)68(103)86-28-14-19-52(86)65(100)77-44(21-23-54(71)89)59(94)76-45(22-24-55(90)91)60(95)82-51(35-88)64(99)83-50(34-87)63(98)81-49(69(104)105)31-40-15-8-7-9-16-40/h7-9,15-16,33,36-39,42-53,56,73,87-88H,10-14,17-32,34-35,70H2,1-6H3,(H2,71,89)(H,72,74)(H,75,92)(H,76,94)(H,77,100)(H,78,93)(H,79,96)(H,80,97)(H,81,98)(H,82,95)(H,83,99)(H,84,101)(H,90,91)(H,104,105)/t42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-,56-/m0/s1 InChIKey=TZPIYZDDBWLKEL-CCZXRIQSSA-N Activity predicted using molecular docking. |
| Database reference: |