BIOPEP-UWM: Report
| ID | 390 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of pancreatic lipase (EC 3.4.23.1) (PDB ID: 1ETH) | |||
| Number of residues | 10 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 1126.2619 | Monoisotopic mass | 1125.5913 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Ajayi F. F., Alyafei A. S., Yap P.-G., Gan C.-Y., Maqsood S. | |
| Title | |
| Unlocking the hypolipidemic potential of bioactive peptides derived from probiotic fermented cattle, camel, goat, and sheep milk: a comprehensive investigation through in vitro, in silico, and molecular docking studies. Front. Sustain. Food Syst., 8, 1443708, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C51H79N15O14/c1-5-27(2)41(65-44(72)32(53)14-9-10-20-52)49(77)63-36(23-31-24-56-26-57-31)50(78)66-21-11-15-38(66)48(76)62-35(22-30-12-7-6-8-13-30)47(75)59-29(4)43(71)60-33(16-18-39(54)68)45(73)58-28(3)42(70)61-34(17-19-40(55)69)46(74)64-37(25-67)51(79)80/h6-8,12-13,24,26-29,32-38,41,67H,5,9-11,14-23,25,52-53H2,1-4H3,(H2,54,68)(H2,55,69)(H,56,57)(H,58,73)(H,59,75)(H,60,71)(H,61,70)(H,62,76)(H,63,77)(H,64,74)(H,65,72)(H,79,80)/t27-,28-,29-,32-,33-,34-,35-,36-,37-,38-,41-/m0/s1 InChIKey=LOMBIDALJORXKH-NVJJDHCGSA-N Activity predicted using molecular docking. |
| Database reference: |