BIOPEP-UWM: Report
| ID | 392 |
| Name | Pancreatic lipase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of pancreatic lipase (EC 3.4.23.1) (PDB ID: 1ETH) | |||
| Number of residues | 11 |
Activity code | plip |
| Activity : | pancreatic lipase inhibitor |
|||
| Chemical mass | 1314.4587 | Monoisotopic mass | 1313.6151 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Ajayi F. F., Alyafei A. S., Yap P.-G., Gan C.-Y., Maqsood S. | |
| Title | |
| Unlocking the hypolipidemic potential of bioactive peptides derived from probiotic fermented cattle, camel, goat, and sheep milk: a comprehensive investigation through in vitro, in silico, and molecular docking studies. Front. Sustain. Food Syst., 8, 1443708, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C56H91N13O21S/c1-28(2)43(53(86)65-38(25-31-13-7-6-8-14-31)51(84)68-44(29(3)71)54(87)62-33(15-9-11-22-57)47(80)64-37(56(89)90)16-10-12-23-58)67-50(83)35(18-20-41(75)76)63-55(88)45(30(4)72)69-52(85)39(27-70)66-48(81)34(17-19-40(73)74)61-49(82)36(21-24-91-5)60-46(79)32(59)26-42(77)78/h6-8,13-14,28-30,32-39,43-45,70-72H,9-12,15-27,57-59H2,1-5H3,(H,60,79)(H,61,82)(H,62,87)(H,63,88)(H,64,80)(H,65,86)(H,66,81)(H,67,83)(H,68,84)(H,69,85)(H,73,74)(H,75,76)(H,77,78)(H,89,90)/t29-,30-,32+,33+,34+,35+,36+,37+,38+,39+,43+,44+,45+/m1/s1 InChIKey=KXLVMTORBYZLOB-IBTFRDHYSA-N Activity predicted using molecular docking. |
| Database reference: |