BIOPEP-UWM: Report
| ID | 4 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Predicted ligand of Keap1 protein (PDB ID: 2FLU) | |||
| Number of residues | 5 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 615.6763 | Monoisotopic mass | 615.3007 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chai T.-T., Koh J.-A., Wong C. C.-C., Sabri M.Z., Wong F.-C. | |
| Title | |
| Computational screening for the anticancer potential of seed-derived antioxidant peptides: a cheminformatic approach. Molecules, 26, 7396, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C29H41N7O8/c1-16(2)10-20(30)25(39)33-21(11-17-5-7-19(38)8-6-17)26(40)35-23(14-37)28(42)36-9-3-4-24(36)27(41)34-22(29(43)44)12-18-13-31-15-32-18/h5-8,13,15-16,20-24,37-38H,3-4,9-12,14,30H2,1-2H3,(H,31,32)(H,33,39)(H,34,41)(H,35,40)(H,43,44)/t20-,21-,22-,23-,24-/m0/s1 InChIKey=PCZZESMVYHDXJE-LSBAASHUSA-N Bioactivity predicted using molecular docking |
| Database reference: |