BIOPEP-UWM: Report
| ID | 40 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Predicted ligand of DNA (PDB ID: 1BNA) and integrins (PDB ID: 4WK0 and 3ZDX) | |||
| Number of residues | 5 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 684.7431 | Monoisotopic mass | 684.3657 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gasymov O., Celik S., Agaeva G., Akyuz S., Kecel-Gunduz S., Qocayev N. M., Ozel A. E. et al. | |
| Title | |
| Evaluation of anti-cancer and anti-covid-19 properties of cationic pentapeptide Glu-Gln-Arg-Pro-Arg, from rice bran protein and its D-isomer analogs through molecular docking simulations. J. Mol. Graph. Model., 108, 107999, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C27H48N12O9/c28-14(7-10-20(41)42)21(43)36-15(8-9-19(29)40)22(44)37-16(4-1-11-34-26(30)31)24(46)39-13-3-6-18(39)23(45)38-17(25(47)48)5-2-12-35-27(32)33/h14-18H,1-13,28H2,(H2,29,40)(H,36,43)(H,37,44)(H,38,45)(H,41,42)(H,47,48)(H4,30,31,34)(H4,32,33,35)/t14-,15-,16+,17-,18-/m0/s1 InChIKey=ITLWNWQWNMPUDO-JCECYMMASA-N Bioactivity predicted using molecular docking |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8252 BIOPEP-UWM Virtual database: ID J-GLOBAL: ID 201707015869560502 Nikkaji: ID J3.575.569A PubChem: CID 53242192 |