BIOPEP-UWM: Report
| ID | 402 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Dipeptidyl peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB ID: 4A5S) | |||
| Number of residues | 11 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1162.2015 | Monoisotopic mass | 1161.5494 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Gan C.-Y., Yap P.-G., Redha A. A., Reem H., Alsaadi S., Mohteshamuddin K., Aguilar-Toalá J. E., Vidal-Limon A. M., Liceaga A. M., Maqsood S. | |
| Title | |
| Exploring the dipeptidyl peptidase IV inhibitory potential of probiotic-fermented milk: An in vitro and in silico comprehensive investigation into peptides from milk of different farm animals. J. Dairy Sci., 107, 10153-10173, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C47H79N13O21/c1-5-21(2)35(58-38(71)24-10-8-16-50-24)45(78)51-18-32(66)52-29(19-61)43(76)54-27(12-14-34(69)70)40(73)56-28(17-31(49)65)42(75)57-30(20-62)44(77)55-26(11-13-33(67)68)39(72)53-25(9-6-7-15-48)41(74)59-36(22(3)63)46(79)60-37(23(4)64)47(80)81/h21-30,35-37,50,61-64H,5-20,48H2,1-4H3,(H2,49,65)(H,51,78)(H,52,66)(H,53,72)(H,54,76)(H,55,77)(H,56,73)(H,57,75)(H,58,71)(H,59,74)(H,60,79)(H,67,68)(H,69,70)(H,80,81)/t21-,22+,23+,24-,25-,26-,27-,28-,29-,30-,35-,36-,37-/m0/s1 InChIKey=QKRJXMFGNJBSIR-BLKGWWJSSA-N Bioactivity predicted by molecular docking |
| Database reference: |