BIOPEP-UWM: Report
| ID | 437 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Dipeptidyl peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB ID: 4A5S) | |||
| Number of residues | 9 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1103.1807 | Monoisotopic mass | 1102.5600 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Gan C.-Y., Yap P.-G., Redha A. A., Reem H., Alsaadi S., Mohteshamuddin K., Aguilar-Toalá J. E., Vidal-Limon A. M., Liceaga A. M., Maqsood S. | |
| Title | |
| Exploring the dipeptidyl peptidase IV inhibitory potential of probiotic-fermented milk: An in vitro and in silico comprehensive investigation into peptides from milk of different farm animals. J. Dairy Sci., 107, 10153-10173, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C45H78N14O18/c1-6-21(4)34(58-36(68)23(47)17-30(48)61)42(74)57-28(18-32(64)65)40(72)53-25(12-13-31(62)63)38(70)55-27(16-20(2)3)39(71)52-24(10-7-8-14-46)37(69)56-29(19-33(66)67)41(73)59-35(22(5)60)43(75)54-26(44(76)77)11-9-15-51-45(49)50/h20-29,34-35,60H,6-19,46-47H2,1-5H3,(H2,48,61)(H,52,71)(H,53,72)(H,54,75)(H,55,70)(H,56,69)(H,57,74)(H,58,68)(H,59,73)(H,62,63)(H,64,65)(H,66,67)(H,76,77)(H4,49,50,51)/t21-,22+,23-,24-,25-,26-,27-,28-,29-,34-,35-/m0/s1 InChIKey=FQWJQFDZYZZSCH-BTWFSYPZSA-N Bioactivity predicted by molecular docking |
| Database reference: |