BIOPEP-UWM: Report
| ID | 44 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 4 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 481.5016 | Monoisotopic mass | 481.2278 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao W., Li W., Yu Z., Wu S., Ding L., Liu J. | |
| Title | |
| Identification of lactoferrin-derived peptides as potential inhibitors against the main protease of SARS-CoV-2. LWT, 154, 112684, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C20H31N7O7/c21-9-16(30)25-15(10-28)18(32)26-13(2-1-7-24-20(22)23)17(31)27-14(19(33)34)8-11-3-5-12(29)6-4-11/h3-6,13-15,28-29H,1-2,7-10,21H2,(H,25,30)(H,26,32)(H,27,31)(H,33,34)(H4,22,23,24)/t13-,14-,15-/m0/s1 InChIKey=ZJWOXBCHKIZHCR-KKUMJFAQSA-N Bioactivity predicted using molecular docking |
| Database reference: |