BIOPEP-UWM: Report
| ID | 46 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 384.4725 | Monoisotopic mass | 384.2478 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao W., Li W., Yu Z., Wu S., Ding L., Liu J. | |
| Title | |
| Identification of lactoferrin-derived peptides as potential inhibitors against the main protease of SARS-CoV-2. LWT, 154, 112684, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)O InChI=1S/C17H32N6O4/c1-10(2)9-11(18)14(24)22-12(5-3-7-21-17(19)20)15(25)23-8-4-6-13(23)16(26)27/h10-13H,3-9,18H2,1-2H3,(H,22,24)(H,26,27)(H4,19,20,21)/t11-,12-,13-/m0/s1 InChIKey=IBMVEYRWAWIOTN-AVGNSLFASA-N Bioactivity predicted using molecular docking Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 3543); the ChEMBL database; the EROP-Moscow database; the MBPDB database |
| Database reference: |
| Database reference: AHTPDB: ID 1168; 1280; 1285; 1635; 1871; 1876; 1932; 1963; 2102; 2565; 2570; 2663; 2732; 2862; 3518; 4801; 5094; 5236; 5608; 5669; 5800; 6280; 6460 BindingDB: ID 50169168 BioPepDB: ID biopep00884 BIOPEP-UWM database of bioactive peptides: ID 3543 BIOPEP-UWM database of sensory peptides and amino acids: ID 437 BRENDA: Ligand Leu-Arg-Pro ChEMBL: ID CHEMBL188695 ChemSpider: ID 8105603 EROP-Moscow: ID E09040 FeptideDB: ID 3543 J-GLOBAL: ID 200907045119827381 MBPDB: Peptide LRP Nikkaji: ID J408.834D PubChem: CID 9929972 SATPdb: ID satpdb28676 ZINC: ID ZINC04899610 |