BIOPEP-UWM: Report
| ID | 462 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Dipeptidyl peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB ID: 4A5S) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 405.3596 | Monoisotopic mass | 405.1490 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mudgil P., Gan C.-Y., Yap P.-G., Redha A. A., Reem H., Alsaadi S., Mohteshamuddin K., Aguilar-Toalá J. E., Vidal-Limon A. M., Liceaga A. M., Maqsood S. | |
| Title | |
| Exploring the dipeptidyl peptidase IV inhibitory potential of probiotic-fermented milk: An in vitro and in silico comprehensive investigation into peptides from milk of different farm animals. J. Dairy Sci., 107, 10153-10173, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C14H23N5O9/c1-5(11(24)18-7(14(27)28)3-9(16)21)17-13(26)8(4-20)19-12(25)6(15)2-10(22)23/h5-8,20H,2-4,15H2,1H3,(H2,16,21)(H,17,26)(H,18,24)(H,19,25)(H,22,23)(H,27,28)/t5-,6-,7-,8-/m0/s1 InChIKey=LEUGJMRLKWRSIH-XAMCCFCMSA-N Bioactivity predicted by molecular docking |
| Database reference: |