BIOPEP-UWM: Report
| ID | 47 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 5 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 477.5323 | Monoisotopic mass | 477.1886 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao W., Li W., Yu Z., Wu S., Ding L., Liu J. | |
| Title | |
| Identification of lactoferrin-derived peptides as potential inhibitors against the main protease of SARS-CoV-2. LWT, 154, 112684, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C18H31N5O8S/c1-9(2)15(18(30)31)23-17(29)11(4-5-32-3)22-13(25)8-20-12(24)7-21-16(28)10(19)6-14(26)27/h9-11,15H,4-8,19H2,1-3H3,(H,20,24)(H,21,28)(H,22,25)(H,23,29)(H,26,27)(H,30,31)/t10-,11-,15-/m0/s1 InChIKey=NUWMNCRFMQCXQL-PGUXBMHVSA-N Bioactivity predicted using molecular docking |
| Database reference: |