BIOPEP-UWM: Report
| ID | 479 |
| Name | Hyaluronidase inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of Hyaluronidase (EC 3.2.1.35) (PDB: ID 2PE4) | |||
| Number of residues | 6 |
Activity code | hyal |
| Activity : | Hyaluronidase inhibitor |
|||
| Chemical mass | 494.5400 | Monoisotopic mass | 494.2481 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xue W., Kuang X., Meng X., Sun B., Zhao Z., Liang G. | |
| Title | |
| Identification and inhibition mechanism of novel collagen-derived hyaluronidase inhibitory peptides. Food Biosci., 66, 106263, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O InChI=1S/C22H34N6O7/c1-13(23)21(34)27-9-2-5-14(27)19(32)24-11-17(29)26-8-4-7-16(26)22(35)28-10-3-6-15(28)20(33)25-12-18(30)31/h13-16H,2-12,23H2,1H3,(H,24,32)(H,25,33)(H,30,31)/t13-,14-,15-,16-/m0/s1 InChIKey=MZPRABJARQFCGA-VGWMRTNUSA-N Bioactivity predicted by molecular docking |
| Database reference: |