BIOPEP-UWM: Report
| ID | 482 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1072.1667 | Monoisotopic mass | 1071.5542 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C45H77N13O17/c1-4-22(2)35(44(73)58-19-9-12-30(58)45(74)75)56-40(69)27(14-16-33(62)63)53-43(72)36(23(3)59)57-39(68)25(11-6-8-18-47)51-42(71)29(21-34(64)65)55-38(67)26(13-15-31(49)60)52-41(70)28(20-32(50)61)54-37(66)24(48)10-5-7-17-46/h22-30,35-36,59H,4-21,46-48H2,1-3H3,(H2,49,60)(H2,50,61)(H,51,71)(H,52,70)(H,53,72)(H,54,66)(H,55,67)(H,56,69)(H,57,68)(H,62,63)(H,64,65)(H,74,75)/t22-,23+,24-,25-,26-,27-,28-,29-,30-,35-,36-/m0/s1 InChIKey=JMMHMWVPZSORAE-CZMZNCBOSA-N Activity predicted using molecular docking |
| Database reference: |