BIOPEP-UWM: Report
| ID | 483 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 818.9095 | Monoisotopic mass | 818.4370 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C35H62N8O14/c1-14(2)12-21(35(56)57)39-33(54)26(18(8)45)42-28(49)17(7)37-32(53)25(16(5)6)41-34(55)27(19(9)46)43-30(51)22(13-44)40-29(50)20(10-11-23(47)48)38-31(52)24(36)15(3)4/h14-22,24-27,44-46H,10-13,36H2,1-9H3,(H,37,53)(H,38,52)(H,39,54)(H,40,50)(H,41,55)(H,42,49)(H,43,51)(H,47,48)(H,56,57)/t17-,18+,19+,20-,21-,22-,24-,25-,26-,27-/m0/s1 InChIKey=OARXSXDGMPKCEC-DCBIMMIJSA-N Activity predicted using molecular docking |
| Database reference: |