BIOPEP-UWM: Report
| ID | 485 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1000.1009 | Monoisotopic mass | 999.5219 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C43H73N11O16/c1-9-20(6)32(52-37(63)25(13-15-29(59)60)47-35(61)23-11-10-16-46-23)41(67)49-26(17-28(45)58)38(64)53-33(21(7)55)42(68)51-30(18(2)3)39(65)48-24(12-14-27(44)57)36(62)50-31(19(4)5)40(66)54-34(22(8)56)43(69)70/h18-26,30-34,46,55-56H,9-17H2,1-8H3,(H2,44,57)(H2,45,58)(H,47,61)(H,48,65)(H,49,67)(H,50,62)(H,51,68)(H,52,63)(H,53,64)(H,54,66)(H,59,60)(H,69,70)/t20-,21+,22+,23-,24-,25-,26-,30-,31-,32-,33-,34-/m0/s1 InChIKey=DXXPFMCAQLESHV-SAEUBGOLSA-N Activity predicted using molecular docking |
| Database reference: |