BIOPEP-UWM: Report
| ID | 487 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 803.8553 | Monoisotopic mass | 803.4011 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C33H57N9O14/c1-7-14(3)24(35)30(52)39-19(11-21(34)45)29(51)42-26(17(6)44)32(54)41-25(15(4)8-2)31(53)37-16(5)27(49)40-20(13-43)28(50)36-12-22(46)38-18(33(55)56)9-10-23(47)48/h14-20,24-26,43-44H,7-13,35H2,1-6H3,(H2,34,45)(H,36,50)(H,37,53)(H,38,46)(H,39,52)(H,40,49)(H,41,54)(H,42,51)(H,47,48)(H,55,56)/t14-,15-,16-,17+,18-,19-,20-,24-,25-,26-/m0/s1 InChIKey=NEKSQCNKOYJVSZ-WTGLCATGSA-N Activity predicted using molecular docking |
| Database reference: |