BIOPEP-UWM: Report
| ID | 489 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1131.2304 | Monoisotopic mass | 1130.5799 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C48H82N12O19/c1-8-21(3)34(44(74)54-29(20-31(51)64)42(72)59-38(25(7)63)48(78)79)55-46(76)37(24(6)62)58-43(73)30-14-12-18-60(30)47(77)35(22(4)9-2)56-41(71)28(15-16-32(65)66)53-45(75)36(23(5)61)57-40(70)27(13-10-11-17-49)52-39(69)26(50)19-33(67)68/h21-30,34-38,61-63H,8-20,49-50H2,1-7H3,(H2,51,64)(H,52,69)(H,53,75)(H,54,74)(H,55,76)(H,56,71)(H,57,70)(H,58,73)(H,59,72)(H,65,66)(H,67,68)(H,78,79)/t21-,22-,23+,24+,25+,26-,27-,28-,29-,30-,34-,35-,36-,37-,38-/m0/s1 InChIKey=SRKGGGBYNRXFMT-UQDUNNBUSA-N Activity predicted using molecular docking |
| Database reference: |