BIOPEP-UWM: Report
| ID | 490 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1067.2361 | Monoisotopic mass | 1066.6116 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C47H82N14O14/c1-3-26(2)38(53)46(73)61-23-11-16-34(61)45(72)60-22-10-15-33(60)44(71)56-28(13-5-8-20-49)39(66)54-27(12-4-7-19-48)40(67)58-31(24-36(52)63)42(69)55-29(17-18-35(51)62)41(68)59-32(25-37(64)65)43(70)57-30(47(74)75)14-6-9-21-50/h26-34,38H,3-25,48-50,53H2,1-2H3,(H2,51,62)(H2,52,63)(H,54,66)(H,55,69)(H,56,71)(H,57,70)(H,58,67)(H,59,68)(H,64,65)(H,74,75)/t26-,27-,28-,29-,30-,31-,32-,33-,34-,38-/m0/s1 InChIKey=HQWPXBWQMQSFJZ-HLXNKHKLSA-N Activity predicted using molecular docking |
| Database reference: |