BIOPEP-UWM: Report
| ID | 491 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 900.9702 | Monoisotopic mass | 900.4537 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C38H64N10O15/c1-7-17(3)28(40)34(58)44-22(14-25(39)51)33(57)47-30(20(6)50)36(60)46-29(18(4)8-2)35(59)42-19(5)31(55)45-23(16-49)32(56)41-15-26(52)43-21(11-12-27(53)54)37(61)48-13-9-10-24(48)38(62)63/h17-24,28-30,49-50H,7-16,40H2,1-6H3,(H2,39,51)(H,41,56)(H,42,59)(H,43,52)(H,44,58)(H,45,55)(H,46,60)(H,47,57)(H,53,54)(H,62,63)/t17-,18-,19-,20+,21-,22-,23-,24-,28-,29-,30-/m0/s1 InChIKey=PJQUHNJBZJHWMS-TWKAHDSGSA-N Activity predicted using molecular docking |
| Database reference: |