BIOPEP-UWM: Report
| ID | 495 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 915.0396 | Monoisotopic mass | 914.5056 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C40H70N10O14/c1-7-19(3)29(36(59)45-25(40(63)64)18-27(43)53)46-38(61)32(22(6)52)49-35(58)26-13-11-17-50(26)39(62)30(20(4)8-2)47-34(57)24(14-15-28(54)55)44-37(60)31(21(5)51)48-33(56)23(42)12-9-10-16-41/h19-26,29-32,51-52H,7-18,41-42H2,1-6H3,(H2,43,53)(H,44,60)(H,45,59)(H,46,61)(H,47,57)(H,48,56)(H,49,58)(H,54,55)(H,63,64)/t19-,20-,21+,22+,23-,24-,25-,26-,29-,30-,31-,32-/m0/s1 InChIKey=LUNLNFORWYQADX-UQDJTSRRSA-N Activity predicted using molecular docking |
| Database reference: |