BIOPEP-UWM: Report
| ID | 497 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 860.9494 | Monoisotopic mass | 860.4588 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C36H64N10O14/c1-9-16(6)24(39)31(54)41-20(12-23(38)51)30(53)45-28(18(8)49)35(58)44-25(14(2)3)32(55)40-19(10-11-22(37)50)29(52)43-26(15(4)5)33(56)46-27(17(7)48)34(57)42-21(13-47)36(59)60/h14-21,24-28,47-49H,9-13,39H2,1-8H3,(H2,37,50)(H2,38,51)(H,40,55)(H,41,54)(H,42,57)(H,43,52)(H,44,58)(H,45,53)(H,46,56)(H,59,60)/t16-,17+,18+,19-,20-,21-,24-,25-,26-,27-,28-/m0/s1 InChIKey=JUWOFWNFHZCQBA-QARXGCSRSA-N Activity predicted using molecular docking |
| Database reference: |