BIOPEP-UWM: Report
| ID | 498 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1087.1780 | Monoisotopic mass | 1086.5538 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C46H78N12O18/c1-9-21(6)34(56-39(68)26(13-15-31(64)65)50-37(66)24-11-10-16-49-24)43(72)52-27(17-30(48)63)40(69)57-36(23(8)61)45(74)55-32(19(2)3)41(70)51-25(12-14-29(47)62)38(67)54-33(20(4)5)42(71)58-35(22(7)60)44(73)53-28(18-59)46(75)76/h19-28,32-36,49,59-61H,9-18H2,1-8H3,(H2,47,62)(H2,48,63)(H,50,66)(H,51,70)(H,52,72)(H,53,73)(H,54,67)(H,55,74)(H,56,68)(H,57,69)(H,58,71)(H,64,65)(H,75,76)/t21-,22+,23+,24-,25-,26-,27-,28-,32-,33-,34-,35-,36-/m0/s1 InChIKey=KDJBWWRUVUACBW-NVLHKOMSSA-N Activity predicted using molecular docking |
| Database reference: |