BIOPEP-UWM: Report
| ID | 5 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Predicted ligand of Keap1 protein (PDB ID: 2FLU) | |||
| Number of residues | 6 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 713.7793 | Monoisotopic mass | 713.3486 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chai T.-T., Koh J.-A., Wong C. C.-C., Sabri M.Z., Wong F.-C. | |
| Title | |
| Computational screening for the anticancer potential of seed-derived antioxidant peptides: a cheminformatic approach. Molecules, 26, 7396, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C33H47N9O9/c1-18(2)11-21(34)32(49)42-10-6-9-26(42)31(48)40-23(13-20-15-36-17-37-20)29(46)38-22(12-19-7-4-3-5-8-19)28(45)39-24(14-27(35)44)30(47)41-25(16-43)33(50)51/h3-5,7-8,15,17-18,21-26,43H,6,9-14,16,34H2,1-2H3,(H2,35,44)(H,36,37)(H,38,46)(H,39,45)(H,40,48)(H,41,47)(H,50,51)/t21-,22-,23-,24-,25-,26-/m0/s1 InChIKey=XIPWPLHJIZWRDN-FRSCJGFNSA-N Bioactivity predicted using molecular docking |
| Database reference: |