BIOPEP-UWM: Report
| ID | 50 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 2 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 249.2879 | Monoisotopic mass | 249.0780 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao W., Li W., Yu Z., Wu S., Ding L., Liu J. | |
| Title | |
| Identification of lactoferrin-derived peptides as potential inhibitors against the main protease of SARS-CoV-2. LWT, 154, 112684, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C8H15N3O4S/c9-4(3-16)7(13)11-5(8(14)15)1-2-6(10)12/h4-5,16H,1-3,9H2,(H2,10,12)(H,11,13)(H,14,15)/t4-,5-/m0/s1 InChIKey=YHDXIZKDOIWPBW-WHFBIAKZSA-N Bioactivity predicted using molecular docking Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the EROP-Moscow database |
| Database reference: |
| ChEBI: ID 157805 ChemSpider: ID 57558418 EPA CompTox: ID DTXSID20658022 EROP-Moscow: ID E23629 J-GLOBAL: ID 200907082950758933 Nikkaji: ID J36.788E PubChem: CID 44243139 SureChEMBL: ID SCHEMBL4227234 |