BIOPEP-UWM: Report
| ID | 500 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1126.2107 | Monoisotopic mass | 1125.5534 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C49H79N11O19/c1-7-24(5)38(46(75)54-29(49(78)79)21-33(51)62)57-42(71)28(15-18-36(67)68)52-43(72)31-11-9-19-59(31)48(77)32-12-10-20-60(32)47(76)30(22-61)55-41(70)27(14-17-35(65)66)53-45(74)39(25(6)8-2)58-44(73)37(23(3)4)56-40(69)26(50)13-16-34(63)64/h23-32,37-39,61H,7-22,50H2,1-6H3,(H2,51,62)(H,52,72)(H,53,74)(H,54,75)(H,55,70)(H,56,69)(H,57,71)(H,58,73)(H,63,64)(H,65,66)(H,67,68)(H,78,79)/t24-,25-,26-,27-,28-,29-,30-,31-,32-,37-,38-,39-/m0/s1 InChIKey=HLDRIGLIQGBHAV-DJNVXLJRSA-N Activity predicted using molecular docking |
| Database reference: |