BIOPEP-UWM: Report
| ID | 501 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1019.1042 | Monoisotopic mass | 1018.5277 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C42H74N12O17/c1-15(2)27(50-41(69)32(21(10)58)52-34(62)22(43)13-26(45)60)37(65)47-23(11-12-25(44)59)35(63)49-28(16(3)4)38(66)54-31(20(9)57)40(68)48-24(14-55)36(64)53-30(19(8)56)39(67)46-18(7)33(61)51-29(17(5)6)42(70)71/h15-24,27-32,55-58H,11-14,43H2,1-10H3,(H2,44,59)(H2,45,60)(H,46,67)(H,47,65)(H,48,68)(H,49,63)(H,50,69)(H,51,61)(H,52,62)(H,53,64)(H,54,66)(H,70,71)/t18-,19+,20+,21+,22-,23-,24-,27-,28-,29-,30-,31-,32-/m0/s1 InChIKey=AMNJPDWRDPRKLU-FSIRIBAQSA-N Activity predicted using molecular docking |
| Database reference: |