BIOPEP-UWM: Report
| ID | 503 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Pedicted ligand of Keap1 (PDB: ID:1U6D) | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 958.0676 | Monoisotopic mass | 957.5227 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Song H., Deng Z., Zou Y., Zhao C., Li J., Zheng L. | |
| Title | |
| Identification of antioxidant oligopeptides targeting Nrf2 from gastrointestinal digestion of casein glycomacropeptide. Int. Dairy J., 168, 106294, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C40H71N13O14/c1-21(54)32(40(66)67)53-37(63)25(11-4-7-17-43)49-39(65)28(20-31(57)58)52-36(62)26(13-14-29(44)55)50-38(64)27(19-30(45)56)51-35(61)24(10-3-6-16-42)48-34(60)23(9-2-5-15-41)47-33(59)22-12-8-18-46-22/h21-28,32,46,54H,2-20,41-43H2,1H3,(H2,44,55)(H2,45,56)(H,47,59)(H,48,60)(H,49,65)(H,50,64)(H,51,61)(H,52,62)(H,53,63)(H,57,58)(H,66,67)/t21-,22+,23+,24+,25+,26+,27+,28+,32+/m1/s1 InChIKey=QOTJKHUNMYAPEE-GVYQRQJZSA-N Activity predicted using molecular docking |
| Database reference: |