BIOPEP-UWM: Report
| ID | 504 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB: ID 1o8a) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1265.3689 | Monoisotopic mass | 1264.5858 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saetang J., Haewphet T., Nilsuwan K., Benjakul S. | |
| Title | |
| ACE- and DPP-IV-inhibitory peptides from bambara groundnut hydrolysate: elucidation using computational tools and molecular docking. Biology, 14, 511, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C61H80N14O16/c1-33(2)22-44(68-51(79)30-66-54(83)47(27-52(80)81)71-55(84)43(10-5-6-20-62)69-53(82)41(63)23-34-12-16-38(77)17-13-34)56(85)70-45(24-35-14-18-39(78)19-15-35)57(86)74-49(31-76)60(89)75-21-7-11-50(75)59(88)72-46(26-37-29-64-32-67-37)58(87)73-48(61(90)91)25-36-28-65-42-9-4-3-8-40(36)42/h3-4,8-9,12-19,28-29,32-33,41,43-50,65,76-78H,5-7,10-11,20-27,30-31,62-63H2,1-2H3,(H,64,67)(H,66,83)(H,68,79)(H,69,82)(H,70,85)(H,71,84)(H,72,88)(H,73,87)(H,74,86)(H,80,81)(H,90,91)/t41-,43-,44-,45-,46-,47-,48-,49-,50-/m0/s1 InChIKey=GHDDYRTXVYEOCE-INXYWQKQSA-N Activity predicted using molecular docking |
| Database reference: |