BIOPEP-UWM: Report
| ID | 505 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB: ID 1o8a) | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 945.1101 | Monoisotopic mass | 944.5314 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saetang J., Haewphet T., Nilsuwan K., Benjakul S. | |
| Title | |
| ACE- and DPP-IV-inhibitory peptides from bambara groundnut hydrolysate: elucidation using computational tools and molecular docking. Biology, 14, 511, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C45H72N10O12/c1-25(2)21-29(47)43(64)54-19-12-17-34(54)41(62)52-36(26(3)4)42(63)51-32(24-56)39(60)53-37(27(5)57)44(65)55-20-11-16-33(55)40(61)48-23-35(58)49-30(15-9-10-18-46)38(59)50-31(45(66)67)22-28-13-7-6-8-14-28/h6-8,13-14,25-27,29-34,36-37,56-57H,9-12,15-24,46-47H2,1-5H3,(H,48,61)(H,49,58)(H,50,59)(H,51,63)(H,52,62)(H,53,60)(H,66,67)/t27-,29+,30+,31+,32+,33+,34+,36+,37+/m1/s1 InChIKey=WKABMIPYVAMGKC-QAYJJHOASA-N Activity predicted using molecular docking |
| Database reference: |