BIOPEP-UWM: Report
| ID | 506 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB: ID 1o8a) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 882.0610 | Monoisotopic mass | 881.5221 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saetang J., Haewphet T., Nilsuwan K., Benjakul S. | |
| Title | |
| ACE- and DPP-IV-inhibitory peptides from bambara groundnut hydrolysate: elucidation using computational tools and molecular docking. Biology, 14, 511, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C42H67N13O8/c1-25(2)23-30(38(60)55-22-10-17-33(55)39(61)54-21-9-16-32(54)35(57)50-28(40(62)63)14-7-19-49-42(46)47)52-34(56)29(24-26-11-4-3-5-12-26)51-36(58)31-15-8-20-53(31)37(59)27(43)13-6-18-48-41(44)45/h3-5,11-12,25,27-33H,6-10,13-24,43H2,1-2H3,(H,50,57)(H,51,58)(H,52,56)(H,62,63)(H4,44,45,48)(H4,46,47,49)/t27-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=JBOZTDXPOJXKOK-MRNVWEPHSA-N Activity predicted using molecular docking |
| Database reference: |