BIOPEP-UWM: Report
| ID | 507 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Predicted ligand of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB: ID 1nu6) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 841.9495 | Monoisotopic mass | 841.4110 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saetang J., Haewphet T., Nilsuwan K., Benjakul S. | |
| Title | |
| ACE- and DPP-IV-inhibitory peptides from bambara groundnut hydrolysate: elucidation using computational tools and molecular docking. Biology, 14, 511, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C43H55N9O9/c44-18-6-5-13-32(43(60)61)48-39(56)36-15-8-20-52(36)42(59)34(22-26-24-47-31-12-4-2-10-28(26)31)50-38(55)33(21-25-23-46-30-11-3-1-9-27(25)30)49-40(57)35-14-7-19-51(35)41(58)29(45)16-17-37(53)54/h1-4,9-12,23-24,29,32-36,46-47H,5-8,13-22,44-45H2,(H,48,56)(H,49,57)(H,50,55)(H,53,54)(H,60,61)/t29-,32-,33-,34-,35-,36-/m0/s1 InChIKey=AZRGTMYNIZGQIP-UJARKJSPSA-N Activity predicted using molecular docking |
| Database reference: |