BIOPEP-UWM: Report
| ID | 508 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Predicted ligand of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB: ID 1nu6) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 717.8934 | Monoisotopic mass | 717.4411 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saetang J., Haewphet T., Nilsuwan K., Benjakul S. | |
| Title | |
| ACE- and DPP-IV-inhibitory peptides from bambara groundnut hydrolysate: elucidation using computational tools and molecular docking. Biology, 14, 511, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C36H59N7O8/c1-21(2)18-25(38)31(45)40-27(19-22(3)4)33(47)42-30(23(5)44)35(49)43-17-11-15-29(43)34(48)39-26(14-9-10-16-37)32(46)41-28(36(50)51)20-24-12-7-6-8-13-24/h6-8,12-13,21-23,25-30,44H,9-11,14-20,37-38H2,1-5H3,(H,39,48)(H,40,45)(H,41,46)(H,42,47)(H,50,51)/t23-,25+,26+,27+,28+,29+,30+/m1/s1 InChIKey=XCOATZAIFITIGV-PEFTXSQWSA-N Activity predicted using molecular docking |
| Database reference: |