BIOPEP-UWM: Report
| ID | 509 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Predicted ligand of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB: ID 1nu6) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 723.8827 | Monoisotopic mass | 723.3726 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saetang J., Haewphet T., Nilsuwan K., Benjakul S. | |
| Title | |
| ACE- and DPP-IV-inhibitory peptides from bambara groundnut hydrolysate: elucidation using computational tools and molecular docking. Biology, 14, 511, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C32H53N9O8S/c1-17(2)11-22(38-27(43)20(33)14-26(34)42)29(45)39-23(12-18(3)4)28(44)37-21(8-10-50-5)31(47)41-9-6-7-25(41)30(46)40-24(32(48)49)13-19-15-35-16-36-19/h15-18,20-25H,6-14,33H2,1-5H3,(H2,34,42)(H,35,36)(H,37,44)(H,38,43)(H,39,45)(H,40,46)(H,48,49)/t20-,21-,22-,23-,24-,25-/m0/s1 InChIKey=ZLVLGIGHQAYVNZ-OOPVGHQCSA-N Activity predicted using molecular docking |
| Database reference: |