BIOPEP-UWM: Report
| ID | 51 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 247.2048 | Monoisotopic mass | 247.0801 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao W., Li W., Yu Z., Wu S., Ding L., Liu J. | |
| Title | |
| Identification of lactoferrin-derived peptides as potential inhibitors against the main protease of SARS-CoV-2. LWT, 154, 112684, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC(=O)O)C(=O)NCC(=O)NCC(=O)O InChI=1S/C8H13N3O6/c9-4(1-6(13)14)8(17)11-2-5(12)10-3-7(15)16/h4H,1-3,9H2,(H,10,12)(H,11,17)(H,13,14)(H,15,16)/t4-/m0/s1 InChIKey=OMMIEVATLAGRCK-BYPYZUCNSA-N Bioactivity predicted using molecular docking Umami enhancing peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 416) |
| Database reference: |
| Database reference: BIOPEP-UWM database of sensory peptides and amino acids: ID 416 BRENDA: Ligand L-Asp-Gly-Gly ChemIDplus: ID 013433197 ChemSpider: ID 2339524 PubChem: CID 3082036 |